C14H13ClN2OS — CID 129127672
(5E)-9-chloro-6-methyl-5-sulfanyl-2,3-dihydro-1H-[1,4]diazocino[1,8-a]indol-4-one (PubChem CID 129127672) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is (5E)-9-chloro-6-methyl-5-sulfanyl-2,3-dihydro-1H-[1,4]diazocino[1,8-a]indol-4-one.
| Compound Name | (5E)-9-chloro-6-methyl-5-sulfanyl-2,3-dihydro-1H-[1,4]diazocino[1,8-a]indol-4-one |
|---|---|
| PubChem CID | 129127672 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | (5E)-9-chloro-6-methyl-5-sulfanyl-2,3-dihydro-1H-[1,4]diazocino[1,8-a]indol-4-one |
| SMILES | C/C1=C(\S)C(=O)NCCn2c1cc1cc(Cl)ccc12 |
| InChI | InChI=1S/C14H13ClN2OS/c1-8-12-7-9-6-10(15)2-3-11(9)17(12)5-4-16-14(18)13(8)19/h2-3,6-7,19H,4-5H2,1H3,(H,16,18)/b13-8+ |
| InChIKey | VLYCMDRFDDCRPB-MDWZMJQESA-N |
| XLogP | 3.09 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|