C52H36N4 — CID 129127715
2-ethenyl-3-phenyl-6-[3-[4-(4-phenylphenyl)quinazolin-2-yl]phenyl]-1-[(Z)-prop-1-enyl]pyrrolo[2,3-k]phenanthridine (PubChem CID 129127715) has the molecular formula C52H36N4 and a molecular weight of 716.89 g/mol. Its IUPAC name is 2-ethenyl-3-phenyl-6-[3-[4-(4-phenylphenyl)quinazolin-2-yl]phenyl]-1-[(Z)-prop-1-enyl]pyrrolo[2,3-k]phenanthridine.
| Compound Name | 2-ethenyl-3-phenyl-6-[3-[4-(4-phenylphenyl)quinazolin-2-yl]phenyl]-1-[(Z)-prop-1-enyl]pyrrolo[2,3-k]phenanthridine |
|---|---|
| PubChem CID | 129127715 |
| Molecular Formula | C52H36N4 |
| Molecular Weight | 716.89 g/mol |
| Exact Mass | 716.29 |
| IUPAC Name | 2-ethenyl-3-phenyl-6-[3-[4-(4-phenylphenyl)quinazolin-2-yl]phenyl]-1-[(Z)-prop-1-enyl]pyrrolo[2,3-k]phenanthridine |
| SMILES | C=Cc1c(/C=C\C)c2c3c(ccc2n1-c1ccccc1)c(-c1cccc(-c2nc(-c4ccc(-c5ccccc5)cc4)c4ccccc4n2)c1)nc1ccccc13 |
| InChI | InChI=1S/C52H36N4/c1-3-16-42-46(4-2)56(39-21-9-6-10-22-39)47-32-31-43-48(49(42)47)40-23-11-13-25-44(40)53-51(43)37-19-15-20-38(33-37)52-54-45-26-14-12-24-41(45)50(55-52)36-29-27-35(28-30-36)34-17-7-5-8-18-34/h3-33H,2H2,1H3/b16-3- |
| InChIKey | YYCJAFJUIXRJRQ-XFQLMFQHSA-N |
| XLogP | 13.62 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.89 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|