About (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one
(5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one (PubChem CID 129128559) has the molecular formula C26H26O5
and a molecular weight of 418.49 g/mol. Its IUPAC name is (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one.
Molecular Properties
| Compound Name | (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one |
| PubChem CID | 129128559 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one |
| SMILES | O=C1O[C@H](COCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C26H26O5/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(31-26)19-28-16-20-10-4-1-5-11-20/h1-15,23-25H,16-19H2/t23-,24?,25?/m1/s1 |
| InChIKey | LDHBSABBBAUMCZ-CZUALIRWSA-N |
| XLogP | 4.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one?
The IUPAC name of (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one (CID 129128559) is (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one.
What is the SMILES notation for (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one?
The canonical SMILES for (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one is O=C1O[C@H](COCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1.
What is the InChIKey of (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one?
The InChIKey is LDHBSABBBAUMCZ-CZUALIRWSA-N. The full InChI is InChI=1S/C26H26O5/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(31-26)19-28-16-20-10-4-1-5-11-20/h1-15,23-25H,16-19H2/t23-,24?,25?/m1/s1.
What are the key properties of (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one?
(5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one has a molecular weight of 418.49 g/mol, XLogP of 4.30, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one is sourced from PubChem (CID 129128559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).