About 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane
8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 129129466) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane |
| PubChem CID | 129129466 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCN1CC2CCC(C1)N2C(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-5-13-8-10-6-7-11(9-13)14(10)12(2,3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | JCWWHKWSZOHCEC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane?
The IUPAC name of 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane (CID 129129466) is 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane?
The canonical SMILES for 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane is CCN1CC2CCC(C1)N2C(C)(C)C.
What is the InChIKey of 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane?
The InChIKey is JCWWHKWSZOHCEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-5-13-8-10-6-7-11(9-13)14(10)12(2,3)4/h10-11H,5-9H2,1-4H3.
What are the key properties of 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane?
8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane has a molecular weight of 196.34 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-3-ethyl-3,8-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 129129466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).