C34H35N2O3+ — CID 129129728
methyl 4-methyl-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoate (PubChem CID 129129728) has the molecular formula C34H35N2O3+ and a molecular weight of 519.67 g/mol. Its IUPAC name is methyl 4-methyl-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoate.
| Compound Name | methyl 4-methyl-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoate |
|---|---|
| PubChem CID | 129129728 |
| Molecular Formula | C34H35N2O3+ |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | methyl 4-methyl-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoate |
| SMILES | COC(=O)c1ccc(C)cc1C1=c2cc3c4c(c2Oc2c1cc1c5c2CCCN5CCC1)CCC[N+]=4CCC3 |
| InChI | InChI=1S/C34H35N2O3/c1-20-11-12-23(34(37)38-2)26(17-20)29-27-18-21-7-3-13-35-15-5-9-24(30(21)35)32(27)39-33-25-10-6-16-36-14-4-8-22(31(25)36)19-28(29)33/h11-12,17-19H,3-10,13-16H2,1-2H3/q+1 |
| InChIKey | OATNZHZITYACDJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|