C17H28O5 — CID 129130194
[(2S,3R,4S,4aS,6R,7R,8aS)-4,7-dimethyl-2-(2-oxoethyl)-6-propyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] acetate (PubChem CID 129130194) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(2S,3R,4S,4aS,6R,7R,8aS)-4,7-dimethyl-2-(2-oxoethyl)-6-propyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] acetate.
| Compound Name | [(2S,3R,4S,4aS,6R,7R,8aS)-4,7-dimethyl-2-(2-oxoethyl)-6-propyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] acetate |
|---|---|
| PubChem CID | 129130194 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(2S,3R,4S,4aS,6R,7R,8aS)-4,7-dimethyl-2-(2-oxoethyl)-6-propyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] acetate |
| SMILES | CCC[C@H]1O[C@H]2[C@H](C)[C@@H](OC(C)=O)[C@H](CC=O)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C17H28O5/c1-5-6-13-10(2)9-15-17(22-13)11(3)16(20-12(4)19)14(21-15)7-8-18/h8,10-11,13-17H,5-7,9H2,1-4H3/t10-,11-,13-,14+,15+,16-,17+/m1/s1 |
| InChIKey | FPGKLYZHTVUSIM-MFBDHMQDSA-N |
| XLogP | 2.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|