C22H34N2 — CID 129130433
(4E,6Z,8E)-2-N-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]-8-[(Z)-prop-1-enyl]undeca-4,6,8-triene-2,5-diamine (PubChem CID 129130433) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is (4E,6Z,8E)-2-N-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]-8-[(Z)-prop-1-enyl]undeca-4,6,8-triene-2,5-diamine.
| Compound Name | (4E,6Z,8E)-2-N-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]-8-[(Z)-prop-1-enyl]undeca-4,6,8-triene-2,5-diamine |
|---|---|
| PubChem CID | 129130433 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | (4E,6Z,8E)-2-N-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]-8-[(Z)-prop-1-enyl]undeca-4,6,8-triene-2,5-diamine |
| SMILES | C/C=C\C(C)=C/C=C/NC(C)C/C=C(N)\C=C/C(/C=C\C)=C/CC |
| InChI | InChI=1S/C22H34N2/c1-6-10-19(4)13-9-18-24-20(5)14-16-22(23)17-15-21(11-7-2)12-8-3/h6-7,9-13,15-18,20,24H,8,14,23H2,1-5H3/b10-6-,11-7-,17-15-,18-9+,19-13-,21-12+,22-16+ |
| InChIKey | YETFQQUFYWVPFZ-SIPAAWMCSA-N |
| XLogP | 5.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|