C9H16N2O2 — CID 129130462
(2S)-2-amino-N-[(2Z,4Z)-hexa-2,4-dienyl]-3-hydroxypropanamide (PubChem CID 129130462) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2Z,4Z)-hexa-2,4-dienyl]-3-hydroxypropanamide.
| Compound Name | (2S)-2-amino-N-[(2Z,4Z)-hexa-2,4-dienyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 129130462 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (2S)-2-amino-N-[(2Z,4Z)-hexa-2,4-dienyl]-3-hydroxypropanamide |
| SMILES | C/C=C\C=C/CNC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C9H16N2O2/c1-2-3-4-5-6-11-9(13)8(10)7-12/h2-5,8,12H,6-7,10H2,1H3,(H,11,13)/b3-2-,5-4-/t8-/m0/s1 |
| InChIKey | ABQPKBJMEDKYBN-GXVIBVIBSA-N |
| XLogP | -0.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|