C21H33F3O — CID 129130662
1-ethyl-4-[4-[(2Z,4E)-4-(trifluoromethoxy)hexa-2,4-dienyl]cyclohexyl]cyclohexane (PubChem CID 129130662) has the molecular formula C21H33F3O and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-ethyl-4-[4-[(2Z,4E)-4-(trifluoromethoxy)hexa-2,4-dienyl]cyclohexyl]cyclohexane.
| Compound Name | 1-ethyl-4-[4-[(2Z,4E)-4-(trifluoromethoxy)hexa-2,4-dienyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 129130662 |
| Molecular Formula | C21H33F3O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1-ethyl-4-[4-[(2Z,4E)-4-(trifluoromethoxy)hexa-2,4-dienyl]cyclohexyl]cyclohexane |
| SMILES | C/C=C(\C=C/CC1CCC(C2CCC(CC)CC2)CC1)OC(F)(F)F |
| InChI | InChI=1S/C21H33F3O/c1-3-16-8-12-18(13-9-16)19-14-10-17(11-15-19)6-5-7-20(4-2)25-21(22,23)24/h4-5,7,16-19H,3,6,8-15H2,1-2H3/b7-5-,20-4+ |
| InChIKey | IHYOCCSOWJRWJC-BRWNMRJLSA-N |
| XLogP | 7.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|