About (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine
(1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine (PubChem CID 129130711) has the molecular formula C5H8FN
and a molecular weight of 101.12 g/mol. Its IUPAC name is (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine |
| PubChem CID | 129130711 |
| Molecular Formula | C5H8FN |
| Molecular Weight | 101.12 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine |
| SMILES | C=C/C(F)=C\NC |
| InChI | InChI=1S/C5H8FN/c1-3-5(6)4-7-2/h3-4,7H,1H2,2H3/b5-4+ |
| InChIKey | SJKXHORALRVVGY-SNAWJCMRSA-N |
| XLogP | 1.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine?
The IUPAC name of (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine (CID 129130711) is (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine.
What is the SMILES notation for (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine?
The canonical SMILES for (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine is C=C/C(F)=C\NC.
What is the InChIKey of (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine?
The InChIKey is SJKXHORALRVVGY-SNAWJCMRSA-N. The full InChI is InChI=1S/C5H8FN/c1-3-5(6)4-7-2/h3-4,7H,1H2,2H3/b5-4+.
What are the key properties of (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine?
(1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine has a molecular weight of 101.12 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-2-fluoro-N-methylbuta-1,3-dien-1-amine is sourced from PubChem (CID 129130711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).