C21H34ClFN8 — CID 129130734
4-N-[(3R,8R)-8-[(2-amino-5-chloropyrimidin-4-yl)amino]-2,2,7,7-tetramethylnonan-3-yl]-5-fluoropyrimidine-2,4-diamine (PubChem CID 129130734) has the molecular formula C21H34ClFN8 and a molecular weight of 453.01 g/mol. Its IUPAC name is 4-N-[(3R,8R)-8-[(2-amino-5-chloropyrimidin-4-yl)amino]-2,2,7,7-tetramethylnonan-3-yl]-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 4-N-[(3R,8R)-8-[(2-amino-5-chloropyrimidin-4-yl)amino]-2,2,7,7-tetramethylnonan-3-yl]-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 129130734 |
| Molecular Formula | C21H34ClFN8 |
| Molecular Weight | 453.01 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 4-N-[(3R,8R)-8-[(2-amino-5-chloropyrimidin-4-yl)amino]-2,2,7,7-tetramethylnonan-3-yl]-5-fluoropyrimidine-2,4-diamine |
| SMILES | C[C@@H](Nc1nc(N)ncc1Cl)C(C)(C)CCC[C@@H](Nc1nc(N)ncc1F)C(C)(C)C |
| InChI | InChI=1S/C21H34ClFN8/c1-12(28-16-13(22)10-26-18(24)30-16)21(5,6)9-7-8-15(20(2,3)4)29-17-14(23)11-27-19(25)31-17/h10-12,15H,7-9H2,1-6H3,(H3,24,26,28,30)(H3,25,27,29,31)/t12-,15-/m1/s1 |
| InChIKey | XVQRJNWKHMXBFS-IUODEOHRSA-N |
| XLogP | 4.75 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.01 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |