C13H13NO4S — CID 12913085
dimethyl 2-methyl-2lambda4-thia-5-azabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene-3,4-dicarboxylate (PubChem CID 12913085) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is dimethyl 2-methyl-2lambda4-thia-5-azabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene-3,4-dicarboxylate.
| Compound Name | dimethyl 2-methyl-2lambda4-thia-5-azabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 12913085 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | dimethyl 2-methyl-2lambda4-thia-5-azabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=Nc2ccccc2S(C)=C1C(=O)OC |
| InChI | InChI=1S/C13H13NO4S/c1-17-12(15)10-11(13(16)18-2)19(3)9-7-5-4-6-8(9)14-10/h4-7H,1-3H3 |
| InChIKey | BSNFXTAMEOQAEL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|