C17H20F3N5OS — CID 129131055
3,3,3-trifluoro-N-[3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]propane-1-sulfinamide (PubChem CID 129131055) has the molecular formula C17H20F3N5OS and a molecular weight of 399.44 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]propane-1-sulfinamide.
| Compound Name | 3,3,3-trifluoro-N-[3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]propane-1-sulfinamide |
|---|---|
| PubChem CID | 129131055 |
| Molecular Formula | C17H20F3N5OS |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3,3,3-trifluoro-N-[3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]propane-1-sulfinamide |
| SMILES | CC1CC(NS(=O)CCC(F)(F)F)CC1c1cnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C17H20F3N5OS/c1-10-6-11(24-27(26)5-3-17(18,19)20)7-12(10)14-8-22-15-9-23-16-13(25(14)15)2-4-21-16/h2,4,8-12,21,24H,3,5-7H2,1H3 |
| InChIKey | CFUUEZOEGIKMHL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |