C19H22F3N5O2S — CID 129131155
(NZ)-N-[[(3R,4S)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methylidene]-3,3,3-trifluoropropane-1-sulfonamide (PubChem CID 129131155) has the molecular formula C19H22F3N5O2S and a molecular weight of 441.48 g/mol. Its IUPAC name is (NZ)-N-[[(3R,4S)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methylidene]-3,3,3-trifluoropropane-1-sulfonamide.
| Compound Name | (NZ)-N-[[(3R,4S)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methylidene]-3,3,3-trifluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 129131155 |
| Molecular Formula | C19H22F3N5O2S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (NZ)-N-[[(3R,4S)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methylidene]-3,3,3-trifluoropropane-1-sulfonamide |
| SMILES | CC[C@@H]1CC(/C=N\S(=O)(=O)CCC(F)(F)F)C[C@@H]1c1cnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C19H22F3N5O2S/c1-2-13-7-12(9-26-30(28,29)6-4-19(20,21)22)8-14(13)16-10-24-17-11-25-18-15(27(16)17)3-5-23-18/h3,5,9-14,23H,2,4,6-8H2,1H3/b26-9-/t12?,13-,14+/m1/s1 |
| InChIKey | PRMQIWUQCHIVDK-UQNGUVANSA-N |
| XLogP | 4.08 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|