C10H13N5 — CID 129131915
6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 129131915) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 129131915 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=C/C=C(\C=C/C)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C10H13N5/c1-3-5-7(6-4-2)8-13-9(11)15-10(12)14-8/h3-6H,1H2,2H3,(H4,11,12,13,14,15)/b6-4-,7-5+ |
| InChIKey | DEUSXRCLTJEDPD-XGXWUAJZSA-N |
| XLogP | 1.18 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|