C9H12N6S — CID 129131941
3-N-[3-(methylsulfanylamino)phenyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 129131941) has the molecular formula C9H12N6S and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-N-[3-(methylsulfanylamino)phenyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-(methylsulfanylamino)phenyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 129131941 |
| Molecular Formula | C9H12N6S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-N-[3-(methylsulfanylamino)phenyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CSNc1cccc(Nc2n[nH]c(N)n2)c1 |
| InChI | InChI=1S/C9H12N6S/c1-16-15-7-4-2-3-6(5-7)11-9-12-8(10)13-14-9/h2-5,15H,1H3,(H4,10,11,12,13,14) |
| InChIKey | MHFZKXFBUMBABT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|