C14H10Cl2N2O3S2 — CID 129132112
2,6-dichloro-N-(3-methylsulfonylphenyl)-4-thionitrosobenzamide (PubChem CID 129132112) has the molecular formula C14H10Cl2N2O3S2 and a molecular weight of 389.29 g/mol. Its IUPAC name is 2,6-dichloro-N-(3-methylsulfonylphenyl)-4-thionitrosobenzamide.
| Compound Name | 2,6-dichloro-N-(3-methylsulfonylphenyl)-4-thionitrosobenzamide |
|---|---|
| PubChem CID | 129132112 |
| Molecular Formula | C14H10Cl2N2O3S2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | 2,6-dichloro-N-(3-methylsulfonylphenyl)-4-thionitrosobenzamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2c(Cl)cc(N=S)cc2Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N2O3S2/c1-23(20,21)10-4-2-3-8(5-10)17-14(19)13-11(15)6-9(18-22)7-12(13)16/h2-7H,1H3,(H,17,19) |
| InChIKey | WBWHBELPAITCRN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |