C33H36Cl2N8O4 — CID 129132217
2-butan-2-yl-4-[4-[2-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]anilino]ethylamino]phenyl]-1,2,4-triazol-3-one (PubChem CID 129132217) has the molecular formula C33H36Cl2N8O4 and a molecular weight of 679.61 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[2-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]anilino]ethylamino]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[2-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]anilino]ethylamino]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 129132217 |
| Molecular Formula | C33H36Cl2N8O4 |
| Molecular Weight | 679.61 g/mol |
| Exact Mass | 678.22 |
| IUPAC Name | 2-butan-2-yl-4-[4-[2-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]anilino]ethylamino]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(NCCNc3ccc(OCC4COC(Cn5cncn5)(c5ccc(Cl)cc5Cl)O4)cc3)cc2)c1=O |
| InChI | InChI=1S/C33H36Cl2N8O4/c1-3-23(2)43-32(44)42(22-40-43)27-9-5-25(6-10-27)37-14-15-38-26-7-11-28(12-8-26)45-17-29-18-46-33(47-29,19-41-21-36-20-39-41)30-13-4-24(34)16-31(30)35/h4-13,16,20-23,29,37-38H,3,14-15,17-19H2,1-2H3 |
| InChIKey | ZGFJYSWGXLFZAG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|