About (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine
(Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine (PubChem CID 129132261) has the molecular formula C12H19FN2
and a molecular weight of 210.30 g/mol. Its IUPAC name is (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine |
| PubChem CID | 129132261 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine |
| SMILES | CN/C=C(/C)C1=C(C)C(F)=CN(C)C1C |
| InChI | InChI=1S/C12H19FN2/c1-8(6-14-4)12-9(2)11(13)7-15(5)10(12)3/h6-7,10,14H,1-5H3/b8-6- |
| InChIKey | GCNKKQMJSHIQLC-VURMDHGXSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine?
The IUPAC name of (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine (CID 129132261) is (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine.
What is the SMILES notation for (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine?
The canonical SMILES for (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine is CN/C=C(/C)C1=C(C)C(F)=CN(C)C1C.
What is the InChIKey of (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine?
The InChIKey is GCNKKQMJSHIQLC-VURMDHGXSA-N. The full InChI is InChI=1S/C12H19FN2/c1-8(6-14-4)12-9(2)11(13)7-15(5)10(12)3/h6-7,10,14H,1-5H3/b8-6-.
What are the key properties of (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine?
(Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine has a molecular weight of 210.30 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(5-fluoro-1,2,4-trimethyl-2H-pyridin-3-yl)-N-methylprop-1-en-1-amine is sourced from PubChem (CID 129132261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).