C21H28ClF3N6O2 — CID 129132549
N-[(1R,2R)-2-[[2-[[(3S)-1-(2-chloroacetyl)piperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]cyclohexyl]prop-2-enamide (PubChem CID 129132549) has the molecular formula C21H28ClF3N6O2 and a molecular weight of 488.94 g/mol. Its IUPAC name is N-[(1R,2R)-2-[[2-[[(3S)-1-(2-chloroacetyl)piperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[(1R,2R)-2-[[2-[[(3S)-1-(2-chloroacetyl)piperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 129132549 |
| Molecular Formula | C21H28ClF3N6O2 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[(1R,2R)-2-[[2-[[(3S)-1-(2-chloroacetyl)piperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCCC[C@H]1Nc1nc(N[C@H]2CCCN(C(=O)CCl)C2)ncc1C(F)(F)F |
| InChI | InChI=1S/C21H28ClF3N6O2/c1-2-17(32)28-15-7-3-4-8-16(15)29-19-14(21(23,24)25)11-26-20(30-19)27-13-6-5-9-31(12-13)18(33)10-22/h2,11,13,15-16H,1,3-10,12H2,(H,28,32)(H2,26,27,29,30)/t13-,15+,16+/m0/s1 |
| InChIKey | LTLGOAYJJJGPLW-NUEKZKHPSA-N |
| XLogP | 3.16 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|