C10H14F3NO — CID 129132997
2,2,2-trifluoro-1-(4-propan-2-yl-3,6-dihydro-2H-pyridin-1-yl)ethanone (PubChem CID 129132997) has the molecular formula C10H14F3NO and a molecular weight of 221.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-propan-2-yl-3,6-dihydro-2H-pyridin-1-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(4-propan-2-yl-3,6-dihydro-2H-pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 129132997 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-propan-2-yl-3,6-dihydro-2H-pyridin-1-yl)ethanone |
| SMILES | CC(C)C1=CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F3NO/c1-7(2)8-3-5-14(6-4-8)9(15)10(11,12)13/h3,7H,4-6H2,1-2H3 |
| InChIKey | YGUDUQCUSMWNTG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|