About magnesium;3-tert-butylphenolate;bromide
magnesium;3-tert-butylphenolate;bromide (PubChem CID 12913334) has the molecular formula C10H13BrMgO
and a molecular weight of 253.42 g/mol. Its IUPAC name is magnesium;3-tert-butylphenolate;bromide.
Molecular Properties
| Compound Name | magnesium;3-tert-butylphenolate;bromide |
| PubChem CID | 12913334 |
| Molecular Formula | C10H13BrMgO |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | magnesium;3-tert-butylphenolate;bromide |
| SMILES | CC(C)(C)c1cccc([O-])c1.[Br-].[Mg+2] |
| InChI | InChI=1S/C10H14O.BrH.Mg/c1-10(2,3)8-5-4-6-9(11)7-8;;/h4-7,11H,1-3H3;1H;/q;;+2/p-2 |
| InChIKey | JHIBIVRJHJEGTO-UHFFFAOYSA-L |
| XLogP | -1.32 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze magnesium;3-tert-butylphenolate;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;3-tert-butylphenolate;bromide?
The IUPAC name of magnesium;3-tert-butylphenolate;bromide (CID 12913334) is magnesium;3-tert-butylphenolate;bromide.
What is the SMILES notation for magnesium;3-tert-butylphenolate;bromide?
The canonical SMILES for magnesium;3-tert-butylphenolate;bromide is CC(C)(C)c1cccc([O-])c1.[Br-].[Mg+2].
What is the InChIKey of magnesium;3-tert-butylphenolate;bromide?
The InChIKey is JHIBIVRJHJEGTO-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H14O.BrH.Mg/c1-10(2,3)8-5-4-6-9(11)7-8;;/h4-7,11H,1-3H3;1H;/q;;+2/p-2.
What are the key properties of magnesium;3-tert-butylphenolate;bromide?
magnesium;3-tert-butylphenolate;bromide has a molecular weight of 253.42 g/mol, XLogP of -1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;3-tert-butylphenolate;bromide is sourced from PubChem (CID 12913334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).