About 3-methyl-[1]benzothiolo[3,2-c]isoquinoline
3-methyl-[1]benzothiolo[3,2-c]isoquinoline (PubChem CID 129134452) has the molecular formula C16H11NS
and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-methyl-[1]benzothiolo[3,2-c]isoquinoline.
Molecular Properties
| Compound Name | 3-methyl-[1]benzothiolo[3,2-c]isoquinoline |
| PubChem CID | 129134452 |
| Molecular Formula | C16H11NS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-methyl-[1]benzothiolo[3,2-c]isoquinoline |
| SMILES | Cc1ccc2c(cnc3c4ccccc4sc23)c1 |
| InChI | InChI=1S/C16H11NS/c1-10-6-7-12-11(8-10)9-17-15-13-4-2-3-5-14(13)18-16(12)15/h2-9H,1H3 |
| InChIKey | MAEKETGWJGZVCD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-[1]benzothiolo[3,2-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-[1]benzothiolo[3,2-c]isoquinoline?
The IUPAC name of 3-methyl-[1]benzothiolo[3,2-c]isoquinoline (CID 129134452) is 3-methyl-[1]benzothiolo[3,2-c]isoquinoline.
What is the SMILES notation for 3-methyl-[1]benzothiolo[3,2-c]isoquinoline?
The canonical SMILES for 3-methyl-[1]benzothiolo[3,2-c]isoquinoline is Cc1ccc2c(cnc3c4ccccc4sc23)c1.
What is the InChIKey of 3-methyl-[1]benzothiolo[3,2-c]isoquinoline?
The InChIKey is MAEKETGWJGZVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NS/c1-10-6-7-12-11(8-10)9-17-15-13-4-2-3-5-14(13)18-16(12)15/h2-9H,1H3.
What are the key properties of 3-methyl-[1]benzothiolo[3,2-c]isoquinoline?
3-methyl-[1]benzothiolo[3,2-c]isoquinoline has a molecular weight of 249.34 g/mol, XLogP of 4.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-[1]benzothiolo[3,2-c]isoquinoline is sourced from PubChem (CID 129134452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).