C24H23F4NO4 — CID 129134546
2,3,4,5-tetrafluoro-6-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-7-carbonyl)benzoic acid (PubChem CID 129134546) has the molecular formula C24H23F4NO4 and a molecular weight of 465.44 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-7-carbonyl)benzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-7-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 129134546 |
| Molecular Formula | C24H23F4NO4 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-7-carbonyl)benzoic acid |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c(O)c(C(=O)c4c(F)c(F)c(F)c(F)c4C(=O)O)cc1c32 |
| InChI | InChI=1S/C24H23F4NO4/c1-23(2)5-7-29-8-6-24(3,4)14-19(29)11(23)9-10(21(14)31)20(30)12-13(22(32)33)16(26)18(28)17(27)15(12)25/h9,31H,5-8H2,1-4H3,(H,32,33) |
| InChIKey | IKRDASUEPDAWOF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|