About N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine
N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine (PubChem CID 129134728) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine.
Molecular Properties
| Compound Name | N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine |
| PubChem CID | 129134728 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine |
| SMILES | CC(CNCN)C1C=CN=CC1N |
| InChI | InChI=1S/C9H18N4/c1-7(4-13-6-10)8-2-3-12-5-9(8)11/h2-3,5,7-9,13H,4,6,10-11H2,1H3 |
| InChIKey | CRCJSJVTQAWRNR-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine?
The IUPAC name of N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine (CID 129134728) is N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine.
What is the SMILES notation for N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine?
The canonical SMILES for N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine is CC(CNCN)C1C=CN=CC1N.
What is the InChIKey of N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine?
The InChIKey is CRCJSJVTQAWRNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-7(4-13-6-10)8-2-3-12-5-9(8)11/h2-3,5,7-9,13H,4,6,10-11H2,1H3.
What are the key properties of N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine?
N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine has a molecular weight of 182.27 g/mol, XLogP of -0.33, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(3-amino-3,4-dihydropyridin-4-yl)propyl]methanediamine is sourced from PubChem (CID 129134728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).