C19H34FN7O2 — CID 129134771
2-amino-6-fluoro-N-[1-methyl-4-(1-methyl-6-oxopiperidin-3-yl)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 129134771) has the molecular formula C19H34FN7O2 and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-[1-methyl-4-(1-methyl-6-oxopiperidin-3-yl)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-fluoro-N-[1-methyl-4-(1-methyl-6-oxopiperidin-3-yl)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 129134771 |
| Molecular Formula | C19H34FN7O2 |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 2-amino-6-fluoro-N-[1-methyl-4-(1-methyl-6-oxopiperidin-3-yl)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CN1CCC(C2CCC(=O)N(C)C2)C(NC(=O)C2C(N)NN3CC(F)CNC23)C1 |
| InChI | InChI=1S/C19H34FN7O2/c1-25-6-5-13(11-3-4-15(28)26(2)8-11)14(10-25)23-19(29)16-17(21)24-27-9-12(20)7-22-18(16)27/h11-14,16-18,22,24H,3-10,21H2,1-2H3,(H,23,29) |
| InChIKey | BJARFKVZAABUQZ-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |