C23H15Cl2N3OS — CID 129135196
1-[(3-chlorophenyl)methyl]-4-[5-(5-chlorothiophen-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one (PubChem CID 129135196) has the molecular formula C23H15Cl2N3OS and a molecular weight of 452.37 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-[5-(5-chlorothiophen-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-[5-(5-chlorothiophen-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one |
|---|---|
| PubChem CID | 129135196 |
| Molecular Formula | C23H15Cl2N3OS |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-[5-(5-chlorothiophen-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one |
| SMILES | O=c1cc(-c2c[nH]c3ncc(-c4ccc(Cl)s4)cc23)ccn1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H15Cl2N3OS/c24-17-3-1-2-14(8-17)13-28-7-6-15(10-22(28)29)19-12-27-23-18(19)9-16(11-26-23)20-4-5-21(25)30-20/h1-12H,13H2,(H,26,27) |
| InChIKey | OIFUBRLTEDUXQP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|