C57H44N2 — CID 129136328
2-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,7-dimethyl-5-[6-phenyl-9-(4-phenylphenyl)carbazol-3-yl]indeno[2,1-b]carbazole (PubChem CID 129136328) has the molecular formula C57H44N2 and a molecular weight of 756.99 g/mol. Its IUPAC name is 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,7-dimethyl-5-[6-phenyl-9-(4-phenylphenyl)carbazol-3-yl]indeno[2,1-b]carbazole.
| Compound Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,7-dimethyl-5-[6-phenyl-9-(4-phenylphenyl)carbazol-3-yl]indeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 129136328 |
| Molecular Formula | C57H44N2 |
| Molecular Weight | 756.99 g/mol |
| Exact Mass | 756.35 |
| IUPAC Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,7-dimethyl-5-[6-phenyl-9-(4-phenylphenyl)carbazol-3-yl]indeno[2,1-b]carbazole |
| SMILES | C/C=C\C(=C/C)c1ccc2c(c1)c1cc3c(cc1n2-c1ccc2c(c1)c1cc(-c4ccccc4)ccc1n2-c1ccc(-c2ccccc2)cc1)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C57H44N2/c1-5-15-37(6-2)41-24-29-54-48(32-41)50-35-46-45-20-13-14-21-51(45)57(3,4)52(46)36-56(50)59(54)44-28-31-55-49(34-44)47-33-42(39-18-11-8-12-19-39)25-30-53(47)58(55)43-26-22-40(23-27-43)38-16-9-7-10-17-38/h5-36H,1-4H3/b15-5-,37-6+ |
| InChIKey | HRYHWBMLDNKMQW-LSCFSVMKSA-N |
| XLogP | 15.50 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.99 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|