C18H16S16 — CID 129136474
7,15-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-2,4,6,8,10,12,14,16-octathiatricyclo[11.3.0.05,9]hexadeca-1(13),5(9)-diene (PubChem CID 129136474) has the molecular formula C18H16S16 and a molecular weight of 745.40 g/mol. Its IUPAC name is 7,15-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-2,4,6,8,10,12,14,16-octathiatricyclo[11.3.0.05,9]hexadeca-1(13),5(9)-diene.
| Compound Name | 7,15-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-2,4,6,8,10,12,14,16-octathiatricyclo[11.3.0.05,9]hexadeca-1(13),5(9)-diene |
|---|---|
| PubChem CID | 129136474 |
| Molecular Formula | C18H16S16 |
| Molecular Weight | 745.40 g/mol |
| Exact Mass | 743.68 |
| IUPAC Name | 7,15-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-2,4,6,8,10,12,14,16-octathiatricyclo[11.3.0.05,9]hexadeca-1(13),5(9)-diene |
| SMILES | CSC1=C(SC)SC(=C2SC3=C(SCSC4=C(SCS3)SC(=C3SC(SC)=C(SC)S3)S4)S2)S1 |
| InChI | InChI=1S/C18H16S16/c1-19-7-8(20-2)28-15(27-7)17-31-11-12(32-17)24-6-26-14-13(25-5-23-11)33-18(34-14)16-29-9(21-3)10(22-4)30-16/h5-6H2,1-4H3 |
| InChIKey | YXYQUJLCSCGZQU-UHFFFAOYSA-N |
| XLogP | 12.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.40 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |