C18H33NO10 — CID 129136835
N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 129136835) has the molecular formula C18H33NO10 and a molecular weight of 423.46 g/mol. Its IUPAC name is N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 129136835 |
| Molecular Formula | C18H33NO10 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | COCCOCCOCCOCCOC[C@@]12CO[C@H](O1)[C@H](NC(C)=O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C18H33NO10/c1-13(20)19-14-15(21)16(22)18(12-28-17(14)29-18)11-27-10-9-26-8-7-25-6-5-24-4-3-23-2/h14-17,21-22H,3-12H2,1-2H3,(H,19,20)/t14-,15-,16-,17-,18+/m1/s1 |
| InChIKey | ZRUWPDABYAWGNX-ZKXLYKBJSA-N |
| XLogP | -1.95 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|