About (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene
(5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene (PubChem CID 129136898) has the molecular formula C13H15BrO
and a molecular weight of 267.17 g/mol. Its IUPAC name is (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene.
Molecular Properties
| Compound Name | (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene |
| PubChem CID | 129136898 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene |
| SMILES | C=C/C=c1/c(Br)ccc/c1=C(/C)OCC |
| InChI | InChI=1S/C13H15BrO/c1-4-7-12-11(10(3)15-5-2)8-6-9-13(12)14/h4,6-9H,1,5H2,2-3H3/b11-10+,12-7+ |
| InChIKey | NAKDDGUSWFPZNE-MLKCCRLUSA-N |
| XLogP | 2.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene?
The IUPAC name of (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene (CID 129136898) is (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene.
What is the SMILES notation for (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene?
The canonical SMILES for (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene is C=C/C=c1/c(Br)ccc/c1=C(/C)OCC.
What is the InChIKey of (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene?
The InChIKey is NAKDDGUSWFPZNE-MLKCCRLUSA-N. The full InChI is InChI=1S/C13H15BrO/c1-4-7-12-11(10(3)15-5-2)8-6-9-13(12)14/h4,6-9H,1,5H2,2-3H3/b11-10+,12-7+.
What are the key properties of (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene?
(5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene has a molecular weight of 267.17 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,6E)-1-bromo-5-(1-ethoxyethylidene)-6-prop-2-enylidenecyclohexa-1,3-diene is sourced from PubChem (CID 129136898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).