About 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile
3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile (PubChem CID 129137287) has the molecular formula C22H18N2O2
and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile.
Molecular Properties
| Compound Name | 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile |
| PubChem CID | 129137287 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile |
| SMILES | N#CCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C22H18N2O2/c23-14-13-21(15-1-7-18(24)8-2-15)22(16-3-9-19(25)10-4-16)17-5-11-20(26)12-6-17/h1-12,25-26H,13,24H2 |
| InChIKey | ZQSSQUNBUFLYKY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile?
The IUPAC name of 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile (CID 129137287) is 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile.
What is the SMILES notation for 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile?
The canonical SMILES for 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile is N#CCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1ccc(N)cc1.
What is the InChIKey of 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile?
The InChIKey is ZQSSQUNBUFLYKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O2/c23-14-13-21(15-1-7-18(24)8-2-15)22(16-3-9-19(25)10-4-16)17-5-11-20(26)12-6-17/h1-12,25-26H,13,24H2.
What are the key properties of 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile?
3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile has a molecular weight of 342.40 g/mol, XLogP of 4.55, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminophenyl)-4,4-bis(4-hydroxyphenyl)but-3-enenitrile is sourced from PubChem (CID 129137287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).