C24H20N2O3 — CID 129137306
4-[1,1-bis(4-hydroxyphenyl)-3-imidazol-1-ylprop-1-en-2-yl]phenol (PubChem CID 129137306) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-[1,1-bis(4-hydroxyphenyl)-3-imidazol-1-ylprop-1-en-2-yl]phenol.
| Compound Name | 4-[1,1-bis(4-hydroxyphenyl)-3-imidazol-1-ylprop-1-en-2-yl]phenol |
|---|---|
| PubChem CID | 129137306 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-[1,1-bis(4-hydroxyphenyl)-3-imidazol-1-ylprop-1-en-2-yl]phenol |
| SMILES | Oc1ccc(C(Cn2ccnc2)=C(c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H20N2O3/c27-20-7-1-17(2-8-20)23(15-26-14-13-25-16-26)24(18-3-9-21(28)10-4-18)19-5-11-22(29)12-6-19/h1-14,16,27-29H,15H2 |
| InChIKey | RCEHDVHLUQMMMG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|