C20H22ClF3N4O — CID 129137388
1-(2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-9-yl)-3-[4-(trifluoromethyl)phenyl]urea;hydrochloride (PubChem CID 129137388) has the molecular formula C20H22ClF3N4O and a molecular weight of 426.87 g/mol. Its IUPAC name is 1-(2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-9-yl)-3-[4-(trifluoromethyl)phenyl]urea;hydrochloride.
| Compound Name | 1-(2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-9-yl)-3-[4-(trifluoromethyl)phenyl]urea;hydrochloride |
|---|---|
| PubChem CID | 129137388 |
| Molecular Formula | C20H22ClF3N4O |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-(2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-9-yl)-3-[4-(trifluoromethyl)phenyl]urea;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(C(F)(F)F)cc1)Nc1ccc2c(c1)CCN1CCNCC21 |
| InChI | InChI=1S/C20H21F3N4O.ClH/c21-20(22,23)14-1-3-15(4-2-14)25-19(28)26-16-5-6-17-13(11-16)7-9-27-10-8-24-12-18(17)27;/h1-6,11,18,24H,7-10,12H2,(H2,25,26,28);1H |
| InChIKey | FSXSDBYCLYRFTE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |