C27H30Cl2F3N2O5S- — CID 129137708
(3R,5R,6S)-3-(carboxymethyl)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-[(2S)-1-[sulfinato(3,3,3-trifluoropropyl)amino]butan-2-yl]piperidine (PubChem CID 129137708) has the molecular formula C27H30Cl2F3N2O5S- and a molecular weight of 622.51 g/mol. Its IUPAC name is (3R,5R,6S)-3-(carboxymethyl)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-[(2S)-1-[sulfinato(3,3,3-trifluoropropyl)amino]butan-2-yl]piperidine.
| Compound Name | (3R,5R,6S)-3-(carboxymethyl)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-[(2S)-1-[sulfinato(3,3,3-trifluoropropyl)amino]butan-2-yl]piperidine |
|---|---|
| PubChem CID | 129137708 |
| Molecular Formula | C27H30Cl2F3N2O5S- |
| Molecular Weight | 622.51 g/mol |
| Exact Mass | 621.12 |
| IUPAC Name | (3R,5R,6S)-3-(carboxymethyl)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-[(2S)-1-[sulfinato(3,3,3-trifluoropropyl)amino]butan-2-yl]piperidine |
| SMILES | CC[C@@H](CN(CCC(F)(F)F)S(=O)[O-])N1C(=O)[C@@](C)(CC(=O)O)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H31Cl2F3N2O5S/c1-3-21(16-33(40(38)39)12-11-27(30,31)32)34-24(17-7-9-19(28)10-8-17)22(18-5-4-6-20(29)13-18)14-26(2,25(34)37)15-23(35)36/h4-10,13,21-22,24H,3,11-12,14-16H2,1-2H3,(H,35,36)(H,38,39)/p-1/t21-,22+,24+,26+/m0/s1 |
| InChIKey | ADWUFBOPLBUPTA-SODSZRCFSA-M |
| XLogP | 6.36 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|