C26H26N2O4 — CID 129137987
2-[[2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-7-methyl-1,3-benzoxazol-5-yl]methylamino]ethanol (PubChem CID 129137987) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-[[2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-7-methyl-1,3-benzoxazol-5-yl]methylamino]ethanol.
| Compound Name | 2-[[2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-7-methyl-1,3-benzoxazol-5-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 129137987 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[[2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-7-methyl-1,3-benzoxazol-5-yl]methylamino]ethanol |
| SMILES | Cc1c(-c2ccc3c(c2)OCCO3)cccc1-c1nc2cc(CNCCO)cc(C)c2o1 |
| InChI | InChI=1S/C26H26N2O4/c1-16-12-18(15-27-8-9-29)13-22-25(16)32-26(28-22)21-5-3-4-20(17(21)2)19-6-7-23-24(14-19)31-11-10-30-23/h3-7,12-14,27,29H,8-11,15H2,1-2H3 |
| InChIKey | MHIGPOAVCFTBOP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|