C20H14ClF7N4O2 — CID 129138246
methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]pyridine-3-carboxylate (PubChem CID 129138246) has the molecular formula C20H14ClF7N4O2 and a molecular weight of 510.80 g/mol. Its IUPAC name is methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]pyridine-3-carboxylate.
| Compound Name | methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 129138246 |
| Molecular Formula | C20H14ClF7N4O2 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cn(-c3c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3C)nn2)cnc1Cl |
| InChI | InChI=1S/C20H14ClF7N4O2/c1-9-4-12(18(22,19(23,24)25)20(26,27)28)5-10(2)15(9)32-8-14(30-31-32)11-6-13(17(33)34-3)16(21)29-7-11/h4-8H,1-3H3 |
| InChIKey | YEFPAQQQEBOIGL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|