C19H36N2O8 — CID 129138358
[(2R,3R,4S,5R,6S)-5-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-3-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 129138358) has the molecular formula C19H36N2O8 and a molecular weight of 420.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-5-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-3-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-5-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-3-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 129138358 |
| Molecular Formula | C19H36N2O8 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-5-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-3-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)O[C@H]1[C@@H](OC)O[C@H](CO)[C@@H](O)[C@@H]1OC(=O)[C@@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C19H36N2O8/c1-6-9(3)12(20)17(24)28-15-14(23)11(8-22)27-19(26-5)16(15)29-18(25)13(21)10(4)7-2/h9-16,19,22-23H,6-8,20-21H2,1-5H3/t9-,10-,11+,12-,13-,14+,15-,16+,19-/m0/s1 |
| InChIKey | JOXJBKGNEDTGOG-UZLRQOESSA-N |
| XLogP | -0.72 |
| TPSA | 163.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |