C37H35F6N3O6 — CID 129138375
2-[4-[2-[2-[bis[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]amino]ethoxy]ethoxy]phenyl]chromen-4-one (PubChem CID 129138375) has the molecular formula C37H35F6N3O6 and a molecular weight of 731.69 g/mol. Its IUPAC name is 2-[4-[2-[2-[bis[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]amino]ethoxy]ethoxy]phenyl]chromen-4-one.
| Compound Name | 2-[4-[2-[2-[bis[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]amino]ethoxy]ethoxy]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 129138375 |
| Molecular Formula | C37H35F6N3O6 |
| Molecular Weight | 731.69 g/mol |
| Exact Mass | 731.24 |
| IUPAC Name | 2-[4-[2-[2-[bis[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]amino]ethoxy]ethoxy]phenyl]chromen-4-one |
| SMILES | Cc1c(OCC(F)(F)F)ccnc1CN(CCOCCOc1ccc(-c2cc(=O)c3ccccc3o2)cc1)Cc1nccc(OCC(F)(F)F)c1C |
| InChI | InChI=1S/C37H35F6N3O6/c1-24-29(44-13-11-32(24)50-22-36(38,39)40)20-46(21-30-25(2)33(12-14-45-30)51-23-37(41,42)43)15-16-48-17-18-49-27-9-7-26(8-10-27)35-19-31(47)28-5-3-4-6-34(28)52-35/h3-14,19H,15-18,20-23H2,1-2H3 |
| InChIKey | BAICOGJTBPUELD-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 96.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.69 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|