C10H16O5 — CID 129138394
3-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propanoic acid (PubChem CID 129138394) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is 3-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propanoic acid.
| Compound Name | 3-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 129138394 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 3-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propanoic acid |
| SMILES | CC1(C)O[C@H]2O[C@@H](CCC(=O)O)C[C@H]2O1 |
| InChI | InChI=1S/C10H16O5/c1-10(2)14-7-5-6(3-4-8(11)12)13-9(7)15-10/h6-7,9H,3-5H2,1-2H3,(H,11,12)/t6-,7+,9+/m0/s1 |
| InChIKey | KTVRQMIUWYABIZ-LKEWCRSYSA-N |
| XLogP | 1.12 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |