3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid

C10H16O4 — CID 129138395

IUPAC3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid
SMILESC=CC[C@@H]1O[C@@H](CCC(=O)O)C[C@H]1O
InChIInChI=1S/C10H16O4/c1-2-3-9-8(11)6-7(14-9)4-5-10(12)13/h2,7-9,11H,1,3-6H2,(H,12,13)/t7-,8+,9-/m0/s1
InChIKeyNVDYTJYJICEBBK-YIZRAAEISA-N
MW200.23 g/mol
LogP0.95
Rot. Bonds5

About 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid

3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid (PubChem CID 129138395) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid.

Molecular Properties

Compound Name3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid
PubChem CID129138395
Molecular FormulaC10H16O4
Molecular Weight200.23 g/mol
Exact Mass200.10
IUPAC Name3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid
SMILESC=CC[C@@H]1O[C@@H](CCC(=O)O)C[C@H]1O
InChIInChI=1S/C10H16O4/c1-2-3-9-8(11)6-7(14-9)4-5-10(12)13/h2,7-9,11H,1,3-6H2,(H,12,13)/t7-,8+,9-/m0/s1
InChIKeyNVDYTJYJICEBBK-YIZRAAEISA-N
XLogP0.95
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 50.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid?
The IUPAC name of 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid (CID 129138395) is 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid.
What is the SMILES notation for 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid?
The canonical SMILES for 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid is C=CC[C@@H]1O[C@@H](CCC(=O)O)C[C@H]1O.
What is the InChIKey of 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid?
The InChIKey is NVDYTJYJICEBBK-YIZRAAEISA-N. The full InChI is InChI=1S/C10H16O4/c1-2-3-9-8(11)6-7(14-9)4-5-10(12)13/h2,7-9,11H,1,3-6H2,(H,12,13)/t7-,8+,9-/m0/s1.
What are the key properties of 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid?
3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid has a molecular weight of 200.23 g/mol, XLogP of 0.95, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]propanoic acid is sourced from PubChem (CID 129138395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).