C23H16BrClN2O2 — CID 129138438
(2R,3S,5S,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-3-carbonitrile (PubChem CID 129138438) has the molecular formula C23H16BrClN2O2 and a molecular weight of 467.75 g/mol. Its IUPAC name is (2R,3S,5S,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-3-carbonitrile.
| Compound Name | (2R,3S,5S,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-3-carbonitrile |
|---|---|
| PubChem CID | 129138438 |
| Molecular Formula | C23H16BrClN2O2 |
| Molecular Weight | 467.75 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | (2R,3S,5S,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-3-carbonitrile |
| SMILES | N#C[C@@H]1C[C@@H](c2ccccc2)[C@]2(c3ccc(Br)cc3)Oc3cc(Cl)cnc3[C@]12O |
| InChI | InChI=1S/C23H16BrClN2O2/c24-17-8-6-15(7-9-17)23-19(14-4-2-1-3-5-14)10-16(12-26)22(23,28)21-20(29-23)11-18(25)13-27-21/h1-9,11,13,16,19,28H,10H2/t16-,19-,22+,23-/m0/s1 |
| InChIKey | PNYXJAFWZKZING-IKPGRFEGSA-N |
| XLogP | 5.30 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.75 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |