C27H27BrN2O6 — CID 129138441
(2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10,12-dimethoxy-N,N-dimethyl-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 129138441) has the molecular formula C27H27BrN2O6 and a molecular weight of 555.43 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10,12-dimethoxy-N,N-dimethyl-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10,12-dimethoxy-N,N-dimethyl-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 129138441 |
| Molecular Formula | C27H27BrN2O6 |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10,12-dimethoxy-N,N-dimethyl-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | COc1cc2c(c(OC)n1)[C@]1(O)[C@H](O)[C@H](C(=O)N(C)C)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C27H27BrN2O6/c1-30(2)25(32)20-21(15-8-6-5-7-9-15)27(16-10-12-17(28)13-11-16)26(33,23(20)31)22-18(36-27)14-19(34-3)29-24(22)35-4/h5-14,20-21,23,31,33H,1-4H3/t20-,21-,23-,26+,27+/m1/s1 |
| InChIKey | CGRBJGYYSFUMSO-WFINZZCUSA-N |
| XLogP | 3.20 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |