C25H21F2NO6 — CID 129138448
(2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylic acid (PubChem CID 129138448) has the molecular formula C25H21F2NO6 and a molecular weight of 469.44 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylic acid.
| Compound Name | (2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 129138448 |
| Molecular Formula | C25H21F2NO6 |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylic acid |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](C(=O)O)[C@@H](c3ccccc3)[C@]1(c1ccc(C(F)F)cc1)O2 |
| InChI | InChI=1S/C25H21F2NO6/c1-33-16-11-28-12-17-20(16)24(32)21(29)18(23(30)31)19(13-5-3-2-4-6-13)25(24,34-17)15-9-7-14(8-10-15)22(26)27/h2-12,18-19,21-22,29,32H,1H3,(H,30,31)/t18-,19-,21-,24+,25+/m1/s1 |
| InChIKey | UBPRSFOXYLUJTE-FGDBOXLNSA-N |
| XLogP | 3.36 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |