C28H20ClN3O5S — CID 129138472
4-[(2S,3S,4R,5S,6R)-10-chloro-2,3-dihydroxy-5-phenyl-4-pyridin-2-ylsulfonyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile (PubChem CID 129138472) has the molecular formula C28H20ClN3O5S and a molecular weight of 546.00 g/mol. Its IUPAC name is 4-[(2S,3S,4R,5S,6R)-10-chloro-2,3-dihydroxy-5-phenyl-4-pyridin-2-ylsulfonyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3S,4R,5S,6R)-10-chloro-2,3-dihydroxy-5-phenyl-4-pyridin-2-ylsulfonyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129138472 |
| Molecular Formula | C28H20ClN3O5S |
| Molecular Weight | 546.00 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | 4-[(2S,3S,4R,5S,6R)-10-chloro-2,3-dihydroxy-5-phenyl-4-pyridin-2-ylsulfonyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@]23Oc4cc(Cl)cnc4[C@]2(O)[C@H](O)[C@H](S(=O)(=O)c2ccccn2)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C28H20ClN3O5S/c29-20-14-21-25(32-16-20)27(34)26(33)24(38(35,36)22-8-4-5-13-31-22)23(18-6-2-1-3-7-18)28(27,37-21)19-11-9-17(15-30)10-12-19/h1-14,16,23-24,26,33-34H/t23-,24-,26-,27+,28+/m1/s1 |
| InChIKey | BZDFPDGRSWAEEY-VBHOFJLSSA-N |
| XLogP | 3.48 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.00 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |