C30H31N3O4 — CID 129138483
4-[(2S,3R,4S,5S,6R)-2,3-dihydroxy-12-methoxy-5-phenyl-4-(piperidin-1-ylmethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile (PubChem CID 129138483) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is 4-[(2S,3R,4S,5S,6R)-2,3-dihydroxy-12-methoxy-5-phenyl-4-(piperidin-1-ylmethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R,4S,5S,6R)-2,3-dihydroxy-12-methoxy-5-phenyl-4-(piperidin-1-ylmethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129138483 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 4-[(2S,3R,4S,5S,6R)-2,3-dihydroxy-12-methoxy-5-phenyl-4-(piperidin-1-ylmethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](CN3CCCCC3)[C@@H](c3ccccc3)[C@]1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C30H31N3O4/c1-36-24-17-32-18-25-27(24)29(35)28(34)23(19-33-14-6-3-7-15-33)26(21-8-4-2-5-9-21)30(29,37-25)22-12-10-20(16-31)11-13-22/h2,4-5,8-13,17-18,23,26,28,34-35H,3,6-7,14-15,19H2,1H3/t23-,26-,28-,29+,30+/m1/s1 |
| InChIKey | PTXSNFPTDGNQJB-KVFFBJIQSA-N |
| XLogP | 3.70 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |