C26H24BrFN2O5 — CID 129138508
(2S,3R,4R,5S,6R)-6-(4-bromophenyl)-N-(2-fluoroethyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 129138508) has the molecular formula C26H24BrFN2O5 and a molecular weight of 543.39 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-N-(2-fluoroethyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-N-(2-fluoroethyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 129138508 |
| Molecular Formula | C26H24BrFN2O5 |
| Molecular Weight | 543.39 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-N-(2-fluoroethyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](C(=O)NCCF)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C26H24BrFN2O5/c1-34-18-13-29-14-19-22(18)25(33)23(31)20(24(32)30-12-11-28)21(15-5-3-2-4-6-15)26(25,35-19)16-7-9-17(27)10-8-16/h2-10,13-14,20-21,23,31,33H,11-12H2,1H3,(H,30,32)/t20-,21-,23-,25+,26+/m1/s1 |
| InChIKey | ZKFAEDZSCCPLTQ-VRFYTPIESA-N |
| XLogP | 3.19 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |