C28H24ClF2N3O4 — CID 129138536
4-[(2S,3R,4S,5S,6R)-10-chloro-4-[(3,3-difluoroazetidin-1-yl)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile (PubChem CID 129138536) has the molecular formula C28H24ClF2N3O4 and a molecular weight of 539.97 g/mol. Its IUPAC name is 4-[(2S,3R,4S,5S,6R)-10-chloro-4-[(3,3-difluoroazetidin-1-yl)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R,4S,5S,6R)-10-chloro-4-[(3,3-difluoroazetidin-1-yl)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129138536 |
| Molecular Formula | C28H24ClF2N3O4 |
| Molecular Weight | 539.97 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 4-[(2S,3R,4S,5S,6R)-10-chloro-4-[(3,3-difluoroazetidin-1-yl)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
| SMILES | COc1nc(Cl)cc2c1[C@]1(O)[C@H](O)[C@H](CN3CC(F)(F)C3)[C@@H](c3ccccc3)[C@]1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C28H24ClF2N3O4/c1-37-25-23-20(11-21(29)33-25)38-28(18-9-7-16(12-32)8-10-18)22(17-5-3-2-4-6-17)19(24(35)27(23,28)36)13-34-14-26(30,31)15-34/h2-11,19,22,24,35-36H,13-15H2,1H3/t19-,22-,24-,27+,28+/m1/s1 |
| InChIKey | MBMWVFNEHILKLR-BVGNYRDYSA-N |
| XLogP | 3.82 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.97 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|