C26H26BrFN2O4 — CID 129138555
(2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-[(2-fluoroethylamino)methyl]-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol (PubChem CID 129138555) has the molecular formula C26H26BrFN2O4 and a molecular weight of 529.41 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-[(2-fluoroethylamino)methyl]-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol.
| Compound Name | (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-[(2-fluoroethylamino)methyl]-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
|---|---|
| PubChem CID | 129138555 |
| Molecular Formula | C26H26BrFN2O4 |
| Molecular Weight | 529.41 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-[(2-fluoroethylamino)methyl]-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](CNCCF)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C26H26BrFN2O4/c1-33-20-14-30-15-21-23(20)25(32)24(31)19(13-29-12-11-28)22(16-5-3-2-4-6-16)26(25,34-21)17-7-9-18(27)10-8-17/h2-10,14-15,19,22,24,29,31-32H,11-13H2,1H3/t19-,22-,24-,25+,26+/m1/s1 |
| InChIKey | DXJBSZTYDFOBET-DMFZTQHLSA-N |
| XLogP | 3.66 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|