C24H20ClN3O5S — CID 129138658
(2S,3S,4R,5S,6R)-10-chloro-6-(4-cyanophenyl)-2,3-dihydroxy-N-methyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide (PubChem CID 129138658) has the molecular formula C24H20ClN3O5S and a molecular weight of 497.96 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-10-chloro-6-(4-cyanophenyl)-2,3-dihydroxy-N-methyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide.
| Compound Name | (2S,3S,4R,5S,6R)-10-chloro-6-(4-cyanophenyl)-2,3-dihydroxy-N-methyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide |
|---|---|
| PubChem CID | 129138658 |
| Molecular Formula | C24H20ClN3O5S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | (2S,3S,4R,5S,6R)-10-chloro-6-(4-cyanophenyl)-2,3-dihydroxy-N-methyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide |
| SMILES | CNS(=O)(=O)[C@H]1[C@@H](O)[C@@]2(O)c3ncc(Cl)cc3O[C@@]2(c2ccc(C#N)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H20ClN3O5S/c1-27-34(31,32)20-19(15-5-3-2-4-6-15)24(16-9-7-14(12-26)8-10-16)23(30,22(20)29)21-18(33-24)11-17(25)13-28-21/h2-11,13,19-20,22,27,29-30H,1H3/t19-,20-,22-,23+,24+/m1/s1 |
| InChIKey | BEUPBRCWWKQRKV-VEEZHQPXSA-N |
| XLogP | 2.16 |
| TPSA | 132.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |